Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Ethylcellulose, 10 mPa.s, NF, 44-51%, Spectrum™ Chemical
CAS: 9004-57-3 Molecular Formula: C23H24N6O4 Molecular Weight (g/mol): 448.48 InChI Key: ARSKJXYLLONUAJ-UHFFFAOYSA-N IUPAC Name: 2-[butyl({4-[2-(2,6-dicyano-4-nitrophenyl)diazen-1-yl]-3-methylphenyl})amino]ethyl acetate SMILES: CCCCN(CCOC(C)=O)C1=CC(C)=C(C=C1)N=NC1=C(C=C(C=C1C#N)[N+]([O-])=O)C#N
| CAS | 9004-57-3 |
|---|---|
| Molecular Weight (g/mol) | 448.48 |
| SMILES | CCCCN(CCOC(C)=O)C1=CC(C)=C(C=C1)N=NC1=C(C=C(C=C1C#N)[N+]([O-])=O)C#N |
| IUPAC Name | 2-[butyl({4-[2-(2,6-dicyano-4-nitrophenyl)diazen-1-yl]-3-methylphenyl})amino]ethyl acetate |
| InChI Key | ARSKJXYLLONUAJ-UHFFFAOYSA-N |
| Molecular Formula | C23H24N6O4 |
| MDL Number | MFCD00011332 |
|---|
1,3-Dihydroxynaphthalene, For Spectrophotometric Det. of Glucuronic Acid According to Tollens, ≥97.0%, MilliporeSigma™ Supelco™
MDL Number: MFCD00003965 Synonym: 1,3-Naphthalenediol; Naphthoresorcinol
| MDL Number | MFCD00003965 |
|---|---|
| Synonym | 1,3-Naphthalenediol; Naphthoresorcinol |
Selectophore™ Chloride ionophore IV, MilliporeSigma™ Supelco™
MDL Number: MFCD06201021 Synonym: 4,5-Bis-[N′-(butyl)thioureido]-2,7-di-tert-butyl-9,9-dimethylxanthene
| MDL Number | MFCD06201021 |
|---|---|
| Synonym | 4,5-Bis-[N′-(butyl)thioureido]-2,7-di-tert-butyl-9,9-dimethylxanthene |
Bathophenanthroline, For Spectrophotometric Det. of Fe in Serum, ≥99.0%, MilliporeSigma™ Supelco™
MDL Number: MFCD00004976 Synonym: 4,7-Diphenyl-1,10-phenanthroline; BPhen
| MDL Number | MFCD00004976 |
|---|---|
| Synonym | 4,7-Diphenyl-1,10-phenanthroline; BPhen |
MilliporeSigma™ EGTA, Molecular Biology Grade, Calbiochem™,
CAS: 67-42-5 Molecular Formula: C14H24N2O10 Molecular Weight (g/mol): 380.35 InChI Key: DEFVIWRASFVYLL-UHFFFAOYSA-N Synonym: egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn PubChem CID: 6207 ChEBI: CHEBI:30740 IUPAC Name: 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid SMILES: C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O
| PubChem CID | 6207 |
|---|---|
| CAS | 67-42-5 |
| Molecular Weight (g/mol) | 380.35 |
| ChEBI | CHEBI:30740 |
| SMILES | C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| Synonym | egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn |
| IUPAC Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | DEFVIWRASFVYLL-UHFFFAOYSA-N |
| Molecular Formula | C14H24N2O10 |
Lecithin, 99.2%, MP Biomedicals™
CAS: 8002-43-5 Molecular Formula: C42H80NO8P Molecular Weight (g/mol): 758.075 InChI Key: JLPULHDHAOZNQI-JLOPVYAASA-N Synonym: 3-sn-phosphatidylcholine,1-hexadecanoyl-2-9e,12e-octadecadienoyl-sn-glycero-3-phosphocholine,1,2-diacyl-sn-glycero-3-phosphocholine,3,5,8-trioxa-4-phosphahexacosa-17,20-dien-1-aminium, 4-hydroxy-n,n,n-trimethyl-9-oxo-7-1-oxohexadecyl oxy methyl-, inner salt, 4-oxide, r,l-,a-lecithin,2-linoleoyl-1-palmitoyl-sn-glycero-3-phosphocholine,a-phosphatidylcholine solution,l-alpha-phosphatidylcholine solution,2-linoleoyl-1-palmitoyl-sn-glyc-ero-3-phosphocholine PubChem CID: 16213884 ChEBI: CHEBI:86658 IUPAC Name: [(2R)-3-hexadecanoyloxy-2-[(9E,12E)-octadeca-9,12-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate SMILES: CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCC=CCCCCC
| PubChem CID | 16213884 |
|---|---|
| CAS | 8002-43-5 |
| Molecular Weight (g/mol) | 758.075 |
| ChEBI | CHEBI:86658 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCC=CCCCCC |
| Synonym | 3-sn-phosphatidylcholine,1-hexadecanoyl-2-9e,12e-octadecadienoyl-sn-glycero-3-phosphocholine,1,2-diacyl-sn-glycero-3-phosphocholine,3,5,8-trioxa-4-phosphahexacosa-17,20-dien-1-aminium, 4-hydroxy-n,n,n-trimethyl-9-oxo-7-1-oxohexadecyl oxy methyl-, inner salt, 4-oxide, r,l-,a-lecithin,2-linoleoyl-1-palmitoyl-sn-glycero-3-phosphocholine,a-phosphatidylcholine solution,l-alpha-phosphatidylcholine solution,2-linoleoyl-1-palmitoyl-sn-glyc-ero-3-phosphocholine |
| IUPAC Name | [(2R)-3-hexadecanoyloxy-2-[(9E,12E)-octadeca-9,12-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| InChI Key | JLPULHDHAOZNQI-JLOPVYAASA-N |
| Molecular Formula | C42H80NO8P |
N-Formylmorpholine, 99%
CAS: 4394-85-8 Molecular Formula: C5H9NO2 Molecular Weight (g/mol): 115.13 MDL Number: MFCD00006170 InChI Key: LCEDQNDDFOCWGG-UHFFFAOYSA-N Synonym: 4-formylmorpholine,n-formylmorpholine,4-morpholinecarboxaldehyde,morpholine, 4-formyl,n-formylmorfolin,4-morpholinecarbaldehyde,n-formylmorfolin czech,unii-d1e63xo4rh,n-formyhnorpholine,n-formyl morpholin PubChem CID: 20417 ChEBI: CHEBI:43989 IUPAC Name: morpholine-4-carbaldehyde SMILES: C1COCCN1C=O
| PubChem CID | 20417 |
|---|---|
| CAS | 4394-85-8 |
| Molecular Weight (g/mol) | 115.13 |
| ChEBI | CHEBI:43989 |
| MDL Number | MFCD00006170 |
| SMILES | C1COCCN1C=O |
| Synonym | 4-formylmorpholine,n-formylmorpholine,4-morpholinecarboxaldehyde,morpholine, 4-formyl,n-formylmorfolin,4-morpholinecarbaldehyde,n-formylmorfolin czech,unii-d1e63xo4rh,n-formyhnorpholine,n-formyl morpholin |
| IUPAC Name | morpholine-4-carbaldehyde |
| InChI Key | LCEDQNDDFOCWGG-UHFFFAOYSA-N |
| Molecular Formula | C5H9NO2 |
Sodium 1-heptanesulfonate monohydrate, 99%
CAS: 207300-90-1 Molecular Formula: C7H17NaO4S Molecular Weight (g/mol): 220.259 MDL Number: MFCD00149550 InChI Key: XWZCREJRXRKIRQ-UHFFFAOYSA-M Synonym: sodium heptane-1-sulfonate hydrate,1-heptanesulfonic acid sodium salt monohydrate,sodium 1-heptanesulfonate monohydrate,sodium 1-heptanesulfonate hydrate,sodium1-heptanesulfonatemonohydrate,potassium heptane-1-sulfonate hydrate,sodium heptane-1-sulfonate-water 1/1/1,sodium 1-heptanesulfonate monohydrate t,sodium 1-heptanesulfonate monohydrate, for hplc PubChem CID: 23687711 IUPAC Name: sodium;heptane-1-sulfonate;hydrate SMILES: CCCCCCCS(=O)(=O)[O-].O.[Na+]
| PubChem CID | 23687711 |
|---|---|
| CAS | 207300-90-1 |
| Molecular Weight (g/mol) | 220.259 |
| MDL Number | MFCD00149550 |
| SMILES | CCCCCCCS(=O)(=O)[O-].O.[Na+] |
| Synonym | sodium heptane-1-sulfonate hydrate,1-heptanesulfonic acid sodium salt monohydrate,sodium 1-heptanesulfonate monohydrate,sodium 1-heptanesulfonate hydrate,sodium1-heptanesulfonatemonohydrate,potassium heptane-1-sulfonate hydrate,sodium heptane-1-sulfonate-water 1/1/1,sodium 1-heptanesulfonate monohydrate t,sodium 1-heptanesulfonate monohydrate, for hplc |
| IUPAC Name | sodium;heptane-1-sulfonate;hydrate |
| InChI Key | XWZCREJRXRKIRQ-UHFFFAOYSA-M |
| Molecular Formula | C7H17NaO4S |
3-Methyl-1-butanol, mixture of isomers, 99%
CAS: 123-51-3 Molecular Formula: C5H12O Molecular Weight (g/mol): 88.15 MDL Number: MFCD00002934 InChI Key: PHTQWCKDNZKARW-UHFFFAOYSA-N Synonym: 3-methyl-1-butanol,isoamyl alcohol,isopentyl alcohol,isopentanol,3-methylbutanol,1-butanol, 3-methyl,isoamylol,isobutylcarbinol,iso-amylalkohol,isobutyl carbinol PubChem CID: 31260 ChEBI: CHEBI:15837 IUPAC Name: 3-methylbutan-1-ol SMILES: CC(C)CCO
| PubChem CID | 31260 |
|---|---|
| CAS | 123-51-3 |
| Molecular Weight (g/mol) | 88.15 |
| ChEBI | CHEBI:15837 |
| MDL Number | MFCD00002934 |
| SMILES | CC(C)CCO |
| Synonym | 3-methyl-1-butanol,isoamyl alcohol,isopentyl alcohol,isopentanol,3-methylbutanol,1-butanol, 3-methyl,isoamylol,isobutylcarbinol,iso-amylalkohol,isobutyl carbinol |
| IUPAC Name | 3-methylbutan-1-ol |
| InChI Key | PHTQWCKDNZKARW-UHFFFAOYSA-N |
| Molecular Formula | C5H12O |
1-Naphthyl isothiocyanate, 98%
CAS: 551-06-4 Molecular Formula: C11H7NS Molecular Weight (g/mol): 185.244 MDL Number: MFCD00003882 InChI Key: JBDOSUUXMYMWQH-UHFFFAOYSA-N Synonym: 1-naphthyl isothiocyanate,1-naphthylisothiocyanate,anit,kesscocide,alpha-naphthyl isothiocyanate,naphthalene, 1-isothiocyanato,naphthalene, isothiocyanato,isothiocyanic acid, 1-naphthyl ester,1-naftylisothiokyanat,isothiocyanic acid 1-naphthyl ester PubChem CID: 11080 ChEBI: CHEBI:35455 IUPAC Name: 1-isothiocyanatonaphthalene SMILES: C1=CC=C2C(=C1)C=CC=C2N=C=S
| PubChem CID | 11080 |
|---|---|
| CAS | 551-06-4 |
| Molecular Weight (g/mol) | 185.244 |
| ChEBI | CHEBI:35455 |
| MDL Number | MFCD00003882 |
| SMILES | C1=CC=C2C(=C1)C=CC=C2N=C=S |
| Synonym | 1-naphthyl isothiocyanate,1-naphthylisothiocyanate,anit,kesscocide,alpha-naphthyl isothiocyanate,naphthalene, 1-isothiocyanato,naphthalene, isothiocyanato,isothiocyanic acid, 1-naphthyl ester,1-naftylisothiokyanat,isothiocyanic acid 1-naphthyl ester |
| IUPAC Name | 1-isothiocyanatonaphthalene |
| InChI Key | JBDOSUUXMYMWQH-UHFFFAOYSA-N |
| Molecular Formula | C11H7NS |
alpha,alpha,alpha-Trifluorotoluene, 99+%
CAS: 98-08-8 Molecular Formula: C7H5F3 Molecular Weight (g/mol): 146.11 MDL Number: MFCD00000372 InChI Key: GETTZEONDQJALK-UHFFFAOYSA-N Synonym: benzotrifluoride,trifluoromethyl benzene,alpha,alpha,alpha-trifluorotoluene,phenylfluoroform,benzene, trifluoromethyl,benzenyl fluoride,benzylidyne fluoride,usaf ma-16,a,a,a-trifluorotoluene,trifluoro toluene PubChem CID: 7368 ChEBI: CHEBI:36810 IUPAC Name: trifluoromethylbenzene SMILES: C1=CC=C(C=C1)C(F)(F)F
| PubChem CID | 7368 |
|---|---|
| CAS | 98-08-8 |
| Molecular Weight (g/mol) | 146.11 |
| ChEBI | CHEBI:36810 |
| MDL Number | MFCD00000372 |
| SMILES | C1=CC=C(C=C1)C(F)(F)F |
| Synonym | benzotrifluoride,trifluoromethyl benzene,alpha,alpha,alpha-trifluorotoluene,phenylfluoroform,benzene, trifluoromethyl,benzenyl fluoride,benzylidyne fluoride,usaf ma-16,a,a,a-trifluorotoluene,trifluoro toluene |
| IUPAC Name | trifluoromethylbenzene |
| InChI Key | GETTZEONDQJALK-UHFFFAOYSA-N |
| Molecular Formula | C7H5F3 |
Tri-n-octylamine, 97%
CAS: 1116-76-3 Molecular Formula: C24H51N Molecular Weight (g/mol): 353.66 InChI Key: XTAZYLNFDRKIHJ-UHFFFAOYSA-N Synonym: trioctylamine,tri-n-octylamine,tricaprylamine,tricaprylylamine,1-octanamine, n,n-dioctyl,tri-n-caprylylamine,alamine 336,alamine 336s,alamine 3365,farmin 08 PubChem CID: 14227 IUPAC Name: N,N-dioctyloctan-1-amine SMILES: CCCCCCCCN(CCCCCCCC)CCCCCCCC
| PubChem CID | 14227 |
|---|---|
| CAS | 1116-76-3 |
| Molecular Weight (g/mol) | 353.66 |
| SMILES | CCCCCCCCN(CCCCCCCC)CCCCCCCC |
| Synonym | trioctylamine,tri-n-octylamine,tricaprylamine,tricaprylylamine,1-octanamine, n,n-dioctyl,tri-n-caprylylamine,alamine 336,alamine 336s,alamine 3365,farmin 08 |
| IUPAC Name | N,N-dioctyloctan-1-amine |
| InChI Key | XTAZYLNFDRKIHJ-UHFFFAOYSA-N |
| Molecular Formula | C24H51N |
2-Bromophenethylamine, 99%
CAS: 65185-58-2 Molecular Formula: C8H10BrN Molecular Weight (g/mol): 200.079 MDL Number: MFCD01529874 InChI Key: ITRNQMJXZUWZQL-UHFFFAOYSA-N Synonym: 2-bromophenethylamine,2-2-bromophenyl ethanamine,2-2-bromophenyl ethylamine,2-2-bromophenyl ethan-1-amine,benzeneethanamine, 2-bromo,2-bromo phenethylamin,2-2-bromopheneyl ethylamine,1-amino-2-bromophenyl ethane,2-bromo phenethylamine,2-bromo-phenethylamine PubChem CID: 2734091 IUPAC Name: 2-(2-bromophenyl)ethanamine SMILES: C1=CC=C(C(=C1)CCN)Br
| PubChem CID | 2734091 |
|---|---|
| CAS | 65185-58-2 |
| Molecular Weight (g/mol) | 200.079 |
| MDL Number | MFCD01529874 |
| SMILES | C1=CC=C(C(=C1)CCN)Br |
| Synonym | 2-bromophenethylamine,2-2-bromophenyl ethanamine,2-2-bromophenyl ethylamine,2-2-bromophenyl ethan-1-amine,benzeneethanamine, 2-bromo,2-bromo phenethylamin,2-2-bromopheneyl ethylamine,1-amino-2-bromophenyl ethane,2-bromo phenethylamine,2-bromo-phenethylamine |
| IUPAC Name | 2-(2-bromophenyl)ethanamine |
| InChI Key | ITRNQMJXZUWZQL-UHFFFAOYSA-N |
| Molecular Formula | C8H10BrN |